C13H15N5O3 — CID 162624366
N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]pyridine-3-carboxamide (PubChem CID 162624366) has the molecular formula C13H15N5O3 and a molecular weight of 289.29 g/mol. Its IUPAC name is N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]pyridine-3-carboxamide.
| Compound Name | N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162624366 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]pyridine-3-carboxamide |
| SMILES | [H]/N=C(\NC(=O)c1cccnc1)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C13H15N5O3/c14-11(16-12(19)8-2-1-5-15-6-8)10-4-3-9-7-17(10)13(20)18(9)21/h1-2,5-6,9-10,21H,3-4,7H2,(H2,14,16,19)/t9-,10+/m1/s1 |
| InChIKey | BJSAAQXZMSPMRP-ZJUUUORDSA-N |
| XLogP | 0.45 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|