C10H16N5NaO6S — CID 162624400
sodium [(2S,5R)-2-[N-(3-aminopropanoyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 162624400) has the molecular formula C10H16N5NaO6S and a molecular weight of 357.32 g/mol. Its IUPAC name is sodium [(2S,5R)-2-[N-(3-aminopropanoyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-2-[N-(3-aminopropanoyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 162624400 |
| Molecular Formula | C10H16N5NaO6S |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | sodium [(2S,5R)-2-[N-(3-aminopropanoyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | [H]/N=C(\NC(=O)CCN)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H17N5O6S.Na/c11-4-3-8(16)13-9(12)7-2-1-6-5-14(7)10(17)15(6)21-22(18,19)20;/h6-7H,1-5,11H2,(H2,12,13,16)(H,18,19,20);/q;+1/p-1/t6-,7+;/m1./s1 |
| InChIKey | LCGUOWLBTXDJPL-HHQFNNIRSA-M |
| XLogP | -4.91 |
| TPSA | 168.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|