C36H57FO4 — CID 162624733
2-[(5S,10S)-11-(3,5-dihydroxyphenyl)-10-methylundecan-5-yl]-5-[(2S,7R)-7-fluoro-2-methylundecyl]benzene-1,3-diol (PubChem CID 162624733) has the molecular formula C36H57FO4 and a molecular weight of 572.85 g/mol. Its IUPAC name is 2-[(5S,10S)-11-(3,5-dihydroxyphenyl)-10-methylundecan-5-yl]-5-[(2S,7R)-7-fluoro-2-methylundecyl]benzene-1,3-diol.
| Compound Name | 2-[(5S,10S)-11-(3,5-dihydroxyphenyl)-10-methylundecan-5-yl]-5-[(2S,7R)-7-fluoro-2-methylundecyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 162624733 |
| Molecular Formula | C36H57FO4 |
| Molecular Weight | 572.85 g/mol |
| Exact Mass | 572.42 |
| IUPAC Name | 2-[(5S,10S)-11-(3,5-dihydroxyphenyl)-10-methylundecan-5-yl]-5-[(2S,7R)-7-fluoro-2-methylundecyl]benzene-1,3-diol |
| SMILES | CCCC[C@@H](F)CCCC[C@H](C)Cc1cc(O)c([C@@H](CCCC)CCCC[C@H](C)Cc2cc(O)cc(O)c2)c(O)c1 |
| InChI | InChI=1S/C36H57FO4/c1-5-7-15-30(16-11-9-13-26(3)19-28-21-32(38)25-33(39)22-28)36-34(40)23-29(24-35(36)41)20-27(4)14-10-12-18-31(37)17-8-6-2/h21-27,30-31,38-41H,5-20H2,1-4H3/t26-,27-,30-,31+/m0/s1 |
| InChIKey | FWCAPQCVEMEGNC-QQPIMWAISA-N |
| XLogP | 10.49 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.85 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|