C19H26O12 — CID 162624781
ethyl (E)-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate (PubChem CID 162624781) has the molecular formula C19H26O12 and a molecular weight of 446.41 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 162624781 |
| Molecular Formula | C19H26O12 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | ethyl (E)-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyprop-2-enoate |
| SMILES | CCOC(=O)/C=C/O[C@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H26O12/c1-6-25-15(24)7-8-26-19-18(30-13(5)23)17(29-12(4)22)16(28-11(3)21)14(31-19)9-27-10(2)20/h7-8,14,16-19H,6,9H2,1-5H3/b8-7+/t14-,16+,17+,18-,19+/m1/s1 |
| InChIKey | YAZDTQHGICECHR-JQMJPDNXSA-N |
| XLogP | 0.16 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|