C28H28F2N4O4 — CID 162624796
N-(4-aminobutyl)-3-[6-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-3-methyl-2-pyridinyl]benzamide (PubChem CID 162624796) has the molecular formula C28H28F2N4O4 and a molecular weight of 522.55 g/mol. Its IUPAC name is N-(4-aminobutyl)-3-[6-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-3-methyl-2-pyridinyl]benzamide.
| Compound Name | N-(4-aminobutyl)-3-[6-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-3-methyl-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 162624796 |
| Molecular Formula | C28H28F2N4O4 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | N-(4-aminobutyl)-3-[6-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-3-methyl-2-pyridinyl]benzamide |
| SMILES | Cc1ccc(NC(=O)C2(c3ccc4c(c3)OC(F)(F)O4)CC2)nc1-c1cccc(C(=O)NCCCCN)c1 |
| InChI | InChI=1S/C28H28F2N4O4/c1-17-7-10-23(33-24(17)18-5-4-6-19(15-18)25(35)32-14-3-2-13-31)34-26(36)27(11-12-27)20-8-9-21-22(16-20)38-28(29,30)37-21/h4-10,15-16H,2-3,11-14,31H2,1H3,(H,32,35)(H,33,34,36) |
| InChIKey | IRVIVZKJLLJZSW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|