C30H32F2N4O4 — CID 162624799
N-(6-aminohexyl)-3-[6-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-3-methyl-2-pyridinyl]benzamide (PubChem CID 162624799) has the molecular formula C30H32F2N4O4 and a molecular weight of 550.61 g/mol. Its IUPAC name is N-(6-aminohexyl)-3-[6-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-3-methyl-2-pyridinyl]benzamide.
| Compound Name | N-(6-aminohexyl)-3-[6-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-3-methyl-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 162624799 |
| Molecular Formula | C30H32F2N4O4 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | N-(6-aminohexyl)-3-[6-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-3-methyl-2-pyridinyl]benzamide |
| SMILES | Cc1ccc(NC(=O)C2(c3ccc4c(c3)OC(F)(F)O4)CC2)nc1-c1cccc(C(=O)NCCCCCCN)c1 |
| InChI | InChI=1S/C30H32F2N4O4/c1-19-9-12-25(35-26(19)20-7-6-8-21(17-20)27(37)34-16-5-3-2-4-15-33)36-28(38)29(13-14-29)22-10-11-23-24(18-22)40-30(31,32)39-23/h6-12,17-18H,2-5,13-16,33H2,1H3,(H,34,37)(H,35,36,38) |
| InChIKey | FSXAZBOKCOLELQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|