C19H20N2O5S — CID 162625100
5-[[4-[2-hydroxy-2-[5-(1-hydroxyethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 162625100) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 5-[[4-[2-hydroxy-2-[5-(1-hydroxyethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-hydroxy-2-[5-(1-hydroxyethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 162625100 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 5-[[4-[2-hydroxy-2-[5-(1-hydroxyethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(O)c1ccc(C(O)COc2ccc(CC3SC(=O)NC3=O)cc2)nc1 |
| InChI | InChI=1S/C19H20N2O5S/c1-11(22)13-4-7-15(20-9-13)16(23)10-26-14-5-2-12(3-6-14)8-17-18(24)21-19(25)27-17/h2-7,9,11,16-17,22-23H,8,10H2,1H3,(H,21,24,25) |
| InChIKey | YYDPBNAZWVLEQF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|