C12H22N2O4S2 — CID 162625192
1,4-dioxa-10,13-dithia-7,16-diazacyclooctadecane-8,15-dione (PubChem CID 162625192) has the molecular formula C12H22N2O4S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1,4-dioxa-10,13-dithia-7,16-diazacyclooctadecane-8,15-dione.
| Compound Name | 1,4-dioxa-10,13-dithia-7,16-diazacyclooctadecane-8,15-dione |
|---|---|
| PubChem CID | 162625192 |
| Molecular Formula | C12H22N2O4S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1,4-dioxa-10,13-dithia-7,16-diazacyclooctadecane-8,15-dione |
| SMILES | O=C1CSCCSCC(=O)NCCOCCOCCN1 |
| InChI | InChI=1S/C12H22N2O4S2/c15-11-9-19-7-8-20-10-12(16)14-2-4-18-6-5-17-3-1-13-11/h1-10H2,(H,13,15)(H,14,16) |
| InChIKey | FOGGHYCGXBVJNR-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |