About 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid
5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid (PubChem CID 162625834) has the molecular formula C19H25FN2O5
and a molecular weight of 380.42 g/mol. Its IUPAC name is 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid |
| PubChem CID | 162625834 |
| Molecular Formula | C19H25FN2O5 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid |
| SMILES | COc1cc(-c2onc(NC(C)CCCC(C)(C)O)c2C(=O)O)ccc1F |
| InChI | InChI=1S/C19H25FN2O5/c1-11(6-5-9-19(2,3)25)21-17-15(18(23)24)16(27-22-17)12-7-8-13(20)14(10-12)26-4/h7-8,10-11,25H,5-6,9H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | QUQIRGGWDYBAED-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid (CID 162625834) is 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid is COc1cc(-c2onc(NC(C)CCCC(C)(C)O)c2C(=O)O)ccc1F.
What is the InChIKey of 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid?
The InChIKey is QUQIRGGWDYBAED-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25FN2O5/c1-11(6-5-9-19(2,3)25)21-17-15(18(23)24)16(27-22-17)12-7-8-13(20)14(10-12)26-4/h7-8,10-11,25H,5-6,9H2,1-4H3,(H,21,22)(H,23,24).
What are the key properties of 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid?
5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid has a molecular weight of 380.42 g/mol, XLogP of 3.93, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluoro-3-methoxyphenyl)-3-[(6-hydroxy-6-methylheptan-2-yl)amino]-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 162625834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).