C17H14N6 — CID 162626213
3-pyrazol-1-yl-N-[3-(1,2,4-triazol-4-yl)phenyl]aniline (PubChem CID 162626213) has the molecular formula C17H14N6 and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-pyrazol-1-yl-N-[3-(1,2,4-triazol-4-yl)phenyl]aniline.
| Compound Name | 3-pyrazol-1-yl-N-[3-(1,2,4-triazol-4-yl)phenyl]aniline |
|---|---|
| PubChem CID | 162626213 |
| Molecular Formula | C17H14N6 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-pyrazol-1-yl-N-[3-(1,2,4-triazol-4-yl)phenyl]aniline |
| SMILES | c1cc(Nc2cccc(-n3cccn3)c2)cc(-n2cnnc2)c1 |
| InChI | InChI=1S/C17H14N6/c1-4-14(10-16(6-1)22-12-18-19-13-22)21-15-5-2-7-17(11-15)23-9-3-8-20-23/h1-13,21H |
| InChIKey | AZIPNSCOEBRAKE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |