C16H18N6O3 — CID 162627413
1-ethyl-N-methyl-5-[[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]amino]pyrazole-4-carboxamide (PubChem CID 162627413) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-ethyl-N-methyl-5-[[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]amino]pyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-methyl-5-[[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162627413 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-ethyl-N-methyl-5-[[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]amino]pyrazole-4-carboxamide |
| SMILES | CCn1ncc(C(=O)NC)c1NC(=O)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C16H18N6O3/c1-3-22-14(12(9-19-22)15(23)17-2)20-16(24)13-6-5-11(25-13)10-21-8-4-7-18-21/h4-9H,3,10H2,1-2H3,(H,17,23)(H,20,24) |
| InChIKey | JSWVNVNUEPXIHO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |