C31H40N6O4S — CID 162627785
(4R,11R,17S)-11-benzyl-4,20-dimethyl-13-(3-methylbut-2-enyl)-17-propan-2-yl-19-oxa-6-thia-3,10,13,16,21,22-hexazatricyclo[16.2.1.15,8]docosa-1(20),5(22),7,18(21)-tetraene-2,9,15-trione (PubChem CID 162627785) has the molecular formula C31H40N6O4S and a molecular weight of 592.77 g/mol. Its IUPAC name is (4R,11R,17S)-11-benzyl-4,20-dimethyl-13-(3-methylbut-2-enyl)-17-propan-2-yl-19-oxa-6-thia-3,10,13,16,21,22-hexazatricyclo[16.2.1.15,8]docosa-1(20),5(22),7,18(21)-tetraene-2,9,15-trione.
| Compound Name | (4R,11R,17S)-11-benzyl-4,20-dimethyl-13-(3-methylbut-2-enyl)-17-propan-2-yl-19-oxa-6-thia-3,10,13,16,21,22-hexazatricyclo[16.2.1.15,8]docosa-1(20),5(22),7,18(21)-tetraene-2,9,15-trione |
|---|---|
| PubChem CID | 162627785 |
| Molecular Formula | C31H40N6O4S |
| Molecular Weight | 592.77 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | (4R,11R,17S)-11-benzyl-4,20-dimethyl-13-(3-methylbut-2-enyl)-17-propan-2-yl-19-oxa-6-thia-3,10,13,16,21,22-hexazatricyclo[16.2.1.15,8]docosa-1(20),5(22),7,18(21)-tetraene-2,9,15-trione |
| SMILES | CC(C)=CCN1CC(=O)N[C@@H](C(C)C)c2nc(c(C)o2)C(=O)N[C@H](C)c2nc(cs2)C(=O)N[C@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C31H40N6O4S/c1-18(2)12-13-37-15-23(14-22-10-8-7-9-11-22)33-28(39)24-17-42-31(34-24)20(5)32-29(40)27-21(6)41-30(36-27)26(19(3)4)35-25(38)16-37/h7-12,17,19-20,23,26H,13-16H2,1-6H3,(H,32,40)(H,33,39)(H,35,38)/t20-,23-,26+/m1/s1 |
| InChIKey | UBTZHKSBQCARTA-WIOYSNFSSA-N |
| XLogP | 4.37 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|