C22H25N5O2 — CID 162629135
[2-(2-aminoethoxy)-5-methylphenyl]-(2-phenyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl)methanone (PubChem CID 162629135) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is [2-(2-aminoethoxy)-5-methylphenyl]-(2-phenyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl)methanone.
| Compound Name | [2-(2-aminoethoxy)-5-methylphenyl]-(2-phenyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl)methanone |
|---|---|
| PubChem CID | 162629135 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [2-(2-aminoethoxy)-5-methylphenyl]-(2-phenyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl)methanone |
| SMILES | Cc1ccc(OCCN)c(C(=O)N2CCc3nc(-c4ccccc4)nn3CC2)c1 |
| InChI | InChI=1S/C22H25N5O2/c1-16-7-8-19(29-14-10-23)18(15-16)22(28)26-11-9-20-24-21(25-27(20)13-12-26)17-5-3-2-4-6-17/h2-8,15H,9-14,23H2,1H3 |
| InChIKey | KPVPMWYTZAKFAG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |