About pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone
pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone (PubChem CID 162629323) has the molecular formula C13H13F3N4O2
and a molecular weight of 314.27 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone |
| PubChem CID | 162629323 |
| Molecular Formula | C13H13F3N4O2 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone |
| SMILES | O=C(c1cnn2cccnc12)N1CCC(OC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H13F3N4O2/c14-13(15,16)22-9-2-6-19(7-3-9)12(21)10-8-18-20-5-1-4-17-11(10)20/h1,4-5,8-9H,2-3,6-7H2 |
| InChIKey | VBUYZMDUIHRESN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone?
The IUPAC name of pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone (CID 162629323) is pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone.
What is the SMILES notation for pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone?
The canonical SMILES for pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone is O=C(c1cnn2cccnc12)N1CCC(OC(F)(F)F)CC1.
What is the InChIKey of pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone?
The InChIKey is VBUYZMDUIHRESN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N4O2/c14-13(15,16)22-9-2-6-19(7-3-9)12(21)10-8-18-20-5-1-4-17-11(10)20/h1,4-5,8-9H,2-3,6-7H2.
What are the key properties of pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone?
pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone has a molecular weight of 314.27 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[1,5-a]pyrimidin-3-yl-[4-(trifluoromethoxy)piperidin-1-yl]methanone is sourced from PubChem (CID 162629323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).