C20H24N6 — CID 162629522
2-[(1R,5S)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-7-methylpurine (PubChem CID 162629522) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[(1R,5S)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-7-methylpurine.
| Compound Name | 2-[(1R,5S)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-7-methylpurine |
|---|---|
| PubChem CID | 162629522 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-[(1R,5S)-3-benzyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]-7-methylpurine |
| SMILES | Cn1cnc2nc(N3C[C@@H]4CC[C@H]3CN(Cc3ccccc3)C4)ncc21 |
| InChI | InChI=1S/C20H24N6/c1-24-14-22-19-18(24)9-21-20(23-19)26-12-16-7-8-17(26)13-25(11-16)10-15-5-3-2-4-6-15/h2-6,9,14,16-17H,7-8,10-13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | DLXURXOIVRFOJV-SJORKVTESA-N |
| XLogP | 2.46 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |