About (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone
(1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone (PubChem CID 162629901) has the molecular formula C13H15F3N4O2
and a molecular weight of 316.28 g/mol. Its IUPAC name is (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone |
| PubChem CID | 162629901 |
| Molecular Formula | C13H15F3N4O2 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone |
| SMILES | Cn1ccn2ncc(C(=O)N3CCC(OC(F)(F)F)CC3)c12 |
| InChI | InChI=1S/C13H15F3N4O2/c1-18-6-7-20-11(18)10(8-17-20)12(21)19-4-2-9(3-5-19)22-13(14,15)16/h6-9H,2-5H2,1H3 |
| InChIKey | RXFILHLHLVGWGW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone?
The IUPAC name of (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone (CID 162629901) is (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone.
What is the SMILES notation for (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone?
The canonical SMILES for (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone is Cn1ccn2ncc(C(=O)N3CCC(OC(F)(F)F)CC3)c12.
What is the InChIKey of (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone?
The InChIKey is RXFILHLHLVGWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3N4O2/c1-18-6-7-20-11(18)10(8-17-20)12(21)19-4-2-9(3-5-19)22-13(14,15)16/h6-9H,2-5H2,1H3.
What are the key properties of (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone?
(1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone has a molecular weight of 316.28 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylimidazo[2,1-e]pyrazol-7-yl)-[4-(trifluoromethoxy)piperidin-1-yl]methanone is sourced from PubChem (CID 162629901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).