About 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol
4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol (PubChem CID 162629950) has the molecular formula C12H10F2N2O
and a molecular weight of 236.22 g/mol. Its IUPAC name is 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol.
Molecular Properties
| Compound Name | 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol |
| PubChem CID | 162629950 |
| Molecular Formula | C12H10F2N2O |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol |
| SMILES | Cc1cnnc(-c2cc(F)c(O)c(F)c2)c1C |
| InChI | InChI=1S/C12H10F2N2O/c1-6-5-15-16-11(7(6)2)8-3-9(13)12(17)10(14)4-8/h3-5,17H,1-2H3 |
| InChIKey | KMFUGSUTMKRKNL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol?
The IUPAC name of 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol (CID 162629950) is 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol.
What is the SMILES notation for 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol?
The canonical SMILES for 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol is Cc1cnnc(-c2cc(F)c(O)c(F)c2)c1C.
What is the InChIKey of 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol?
The InChIKey is KMFUGSUTMKRKNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N2O/c1-6-5-15-16-11(7(6)2)8-3-9(13)12(17)10(14)4-8/h3-5,17H,1-2H3.
What are the key properties of 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol?
4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol has a molecular weight of 236.22 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dimethylpyridazin-3-yl)-2,6-difluorophenol is sourced from PubChem (CID 162629950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).