About 1-bromo-4-ethenylbenzene
1-bromo-4-ethenylbenzene (PubChem CID 16263) has the molecular formula C8H7Br
and a molecular weight of 183.05 g/mol. Its IUPAC name is 1-bromo-4-ethenylbenzene.
Molecular Properties
| Compound Name | 1-bromo-4-ethenylbenzene |
| PubChem CID | 16263 |
| Molecular Formula | C8H7Br |
| Molecular Weight | 183.05 g/mol |
| Exact Mass | 181.97 |
| IUPAC Name | 1-bromo-4-ethenylbenzene |
| SMILES | C=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H7Br/c1-2-7-3-5-8(9)6-4-7/h2-6H,1H2 |
| InChIKey | WGGLDBIZIQMEGH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.05 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-4-ethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-ethenylbenzene?
The IUPAC name of 1-bromo-4-ethenylbenzene (CID 16263) is 1-bromo-4-ethenylbenzene.
What is the SMILES notation for 1-bromo-4-ethenylbenzene?
The canonical SMILES for 1-bromo-4-ethenylbenzene is C=Cc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-ethenylbenzene?
The InChIKey is WGGLDBIZIQMEGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br/c1-2-7-3-5-8(9)6-4-7/h2-6H,1H2.
What are the key properties of 1-bromo-4-ethenylbenzene?
1-bromo-4-ethenylbenzene has a molecular weight of 183.05 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-ethenylbenzene is sourced from PubChem (CID 16263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).