C16H21N3O2 — CID 162630546
[(3aR,6aS)-5-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 162630546) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is [(3aR,6aS)-5-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aR,6aS)-5-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 162630546 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [(3aR,6aS)-5-[(6-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | Cc1ccc2nc(CN3C[C@H]4COC[C@@]4(CO)C3)cn2c1 |
| InChI | InChI=1S/C16H21N3O2/c1-12-2-3-15-17-14(7-19(15)4-12)6-18-5-13-8-21-11-16(13,9-18)10-20/h2-4,7,13,20H,5-6,8-11H2,1H3/t13-,16-/m0/s1 |
| InChIKey | IVGCBOBOFMCSPN-BBRMVZONSA-N |
| XLogP | 1.08 |
| TPSA | 50.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |