C21H22N4O2 — CID 162630664
(3S,4S)-1-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)-4-phenylpiperidine-3,4-diol (PubChem CID 162630664) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (3S,4S)-1-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)-4-phenylpiperidine-3,4-diol.
| Compound Name | (3S,4S)-1-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)-4-phenylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 162630664 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (3S,4S)-1-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)-4-phenylpiperidine-3,4-diol |
| SMILES | Cc1cc(N2CC[C@](O)(c3ccccc3)[C@@H](O)C2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C21H22N4O2/c1-15-12-19(24-20(23-15)16-6-5-10-22-13-16)25-11-9-21(27,18(26)14-25)17-7-3-2-4-8-17/h2-8,10,12-13,18,26-27H,9,11,14H2,1H3/t18-,21-/m0/s1 |
| InChIKey | NDSGZUJECZETGQ-RXVVDRJESA-N |
| XLogP | 2.31 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |