C17H29N5O3 — CID 162630968
6-[4-[(dimethylamino)methyl]-4-methoxypiperidine-1-carbonyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 162630968) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 6-[4-[(dimethylamino)methyl]-4-methoxypiperidine-1-carbonyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 6-[4-[(dimethylamino)methyl]-4-methoxypiperidine-1-carbonyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 162630968 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 6-[4-[(dimethylamino)methyl]-4-methoxypiperidine-1-carbonyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | COC1(CN(C)C)CCN(C(=O)C2CCc3nn(C)c(=O)n3C2)CC1 |
| InChI | InChI=1S/C17H29N5O3/c1-19(2)12-17(25-4)7-9-21(10-8-17)15(23)13-5-6-14-18-20(3)16(24)22(14)11-13/h13H,5-12H2,1-4H3 |
| InChIKey | JLJPZQFVQYJXPS-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 72.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |