C18H22N4O2S — CID 162631010
N-[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-2-amino-N-methyl-1,3-benzothiazole-5-carboxamide (PubChem CID 162631010) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-2-amino-N-methyl-1,3-benzothiazole-5-carboxamide.
| Compound Name | N-[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-2-amino-N-methyl-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 162631010 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[(4aS,6S,7aS)-2-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-6-yl]-2-amino-N-methyl-1,3-benzothiazole-5-carboxamide |
| SMILES | CN1C[C@H]2C[C@@H](N(C)C(=O)c3ccc4sc(N)nc4c3)C[C@H]2CC1=O |
| InChI | InChI=1S/C18H22N4O2S/c1-21-9-12-6-13(5-11(12)8-16(21)23)22(2)17(24)10-3-4-15-14(7-10)20-18(19)25-15/h3-4,7,11-13H,5-6,8-9H2,1-2H3,(H2,19,20)/t11-,12+,13-/m0/s1 |
| InChIKey | KJJPLHJDPGZHKR-XQQFMLRXSA-N |
| XLogP | 2.21 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |