C15H21FN4O2 — CID 162631691
(4aS,6S,7aS)-6-[(5-fluoro-4-methoxypyrimidin-2-yl)-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one (PubChem CID 162631691) has the molecular formula C15H21FN4O2 and a molecular weight of 308.36 g/mol. Its IUPAC name is (4aS,6S,7aS)-6-[(5-fluoro-4-methoxypyrimidin-2-yl)-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one.
| Compound Name | (4aS,6S,7aS)-6-[(5-fluoro-4-methoxypyrimidin-2-yl)-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 162631691 |
| Molecular Formula | C15H21FN4O2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (4aS,6S,7aS)-6-[(5-fluoro-4-methoxypyrimidin-2-yl)-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
| SMILES | COc1nc(N(C)[C@H]2C[C@H]3CC(=O)N(C)C[C@H]3C2)ncc1F |
| InChI | InChI=1S/C15H21FN4O2/c1-19-8-10-5-11(4-9(10)6-13(19)21)20(2)15-17-7-12(16)14(18-15)22-3/h7,9-11H,4-6,8H2,1-3H3/t9-,10+,11-/m0/s1 |
| InChIKey | OONWYLIUIJHNDQ-AXFHLTTASA-N |
| XLogP | 1.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |