C15H23ClN4O — CID 162632133
(4aS,6S,7aS)-6-[2-(4-chloropyrazol-1-yl)ethyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one (PubChem CID 162632133) has the molecular formula C15H23ClN4O and a molecular weight of 310.83 g/mol. Its IUPAC name is (4aS,6S,7aS)-6-[2-(4-chloropyrazol-1-yl)ethyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one.
| Compound Name | (4aS,6S,7aS)-6-[2-(4-chloropyrazol-1-yl)ethyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 162632133 |
| Molecular Formula | C15H23ClN4O |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (4aS,6S,7aS)-6-[2-(4-chloropyrazol-1-yl)ethyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
| SMILES | CN1C[C@H]2C[C@@H](N(C)CCn3cc(Cl)cn3)C[C@H]2CC1=O |
| InChI | InChI=1S/C15H23ClN4O/c1-18(3-4-20-10-13(16)8-17-20)14-5-11-7-15(21)19(2)9-12(11)6-14/h8,10-12,14H,3-7,9H2,1-2H3/t11-,12+,14-/m0/s1 |
| InChIKey | MFWVHTWYAJWWAP-SCRDCRAPSA-N |
| XLogP | 1.73 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |