C17H27N5O2 — CID 162632236
ethyl 4-(2-cyclopropyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl)piperidine-1-carboxylate (PubChem CID 162632236) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is ethyl 4-(2-cyclopropyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(2-cyclopropyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162632236 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | ethyl 4-(2-cyclopropyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepin-7-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCc3nc(C4CC4)nn3CC2)CC1 |
| InChI | InChI=1S/C17H27N5O2/c1-2-24-17(23)21-8-5-14(6-9-21)20-10-7-15-18-16(13-3-4-13)19-22(15)12-11-20/h13-14H,2-12H2,1H3 |
| InChIKey | ZQIWXGUYIBXUHB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |