C23H28N2O2 — CID 162632603
[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-methyl-4-phenyl-3-pyridinyl)methanone (PubChem CID 162632603) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-methyl-4-phenyl-3-pyridinyl)methanone.
| Compound Name | [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-methyl-4-phenyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 162632603 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-methyl-4-phenyl-3-pyridinyl)methanone |
| SMILES | CC[C@]1(O)CCC[C@H]2CN(C(=O)c3c(-c4ccccc4)ccnc3C)C[C@H]21 |
| InChI | InChI=1S/C23H28N2O2/c1-3-23(27)12-7-10-18-14-25(15-20(18)23)22(26)21-16(2)24-13-11-19(21)17-8-5-4-6-9-17/h4-6,8-9,11,13,18,20,27H,3,7,10,12,14-15H2,1-2H3/t18-,20+,23-/m0/s1 |
| InChIKey | PJXJAOMBSFCRNZ-NOXFTYBFSA-N |
| XLogP | 4.07 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |