About 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one
6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one (PubChem CID 162632607) has the molecular formula C20H21N3O4S
and a molecular weight of 399.47 g/mol. Its IUPAC name is 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one.
Molecular Properties
| Compound Name | 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one |
| PubChem CID | 162632607 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one |
| SMILES | CN1CCCC2(CCCN2S(=O)(=O)c2ccc3c4c(cccc24)C(=O)N3)C1=O |
| InChI | InChI=1S/C20H21N3O4S/c1-22-11-3-9-20(19(22)25)10-4-12-23(20)28(26,27)16-8-7-15-17-13(16)5-2-6-14(17)18(24)21-15/h2,5-8H,3-4,9-12H2,1H3,(H,21,24) |
| InChIKey | UDWJSSNTFGUNSB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one?
The IUPAC name of 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one (CID 162632607) is 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one.
What is the SMILES notation for 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one?
The canonical SMILES for 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one is CN1CCCC2(CCCN2S(=O)(=O)c2ccc3c4c(cccc24)C(=O)N3)C1=O.
What is the InChIKey of 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one?
The InChIKey is UDWJSSNTFGUNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O4S/c1-22-11-3-9-20(19(22)25)10-4-12-23(20)28(26,27)16-8-7-15-17-13(16)5-2-6-14(17)18(24)21-15/h2,5-8H,3-4,9-12H2,1H3,(H,21,24).
What are the key properties of 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one?
6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one has a molecular weight of 399.47 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(9-methyl-10-oxo-1,9-diazaspiro[4.5]decan-1-yl)sulfonyl]-1H-benzo[cd]indol-2-one is sourced from PubChem (CID 162632607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).