C15H19Cl2NO — CID 162634414
(1R,5S)-9-[(2,6-dichlorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 162634414) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is (1R,5S)-9-[(2,6-dichlorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | (1R,5S)-9-[(2,6-dichlorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 162634414 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (1R,5S)-9-[(2,6-dichlorophenyl)methyl]-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | OC1C[C@H]2CCC[C@@H](C1)N2Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H19Cl2NO/c16-14-5-2-6-15(17)13(14)9-18-10-3-1-4-11(18)8-12(19)7-10/h2,5-6,10-12,19H,1,3-4,7-9H2/t10-,11+,12? |
| InChIKey | SOLGNWFOPGLGCZ-FOSCPWQOSA-N |
| XLogP | 3.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |