C19H31N5O2S — CID 162634594
(1S,3R,4R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)amino]-N-(cyclohexen-1-ylmethyl)-4-propoxycyclohexane-1-carboxamide (PubChem CID 162634594) has the molecular formula C19H31N5O2S and a molecular weight of 393.56 g/mol. Its IUPAC name is (1S,3R,4R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)amino]-N-(cyclohexen-1-ylmethyl)-4-propoxycyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)amino]-N-(cyclohexen-1-ylmethyl)-4-propoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 162634594 |
| Molecular Formula | C19H31N5O2S |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (1S,3R,4R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)amino]-N-(cyclohexen-1-ylmethyl)-4-propoxycyclohexane-1-carboxamide |
| SMILES | CCCO[C@@H]1CC[C@H](C(=O)NCC2=CCCCC2)C[C@H]1Nc1nnc(N)s1 |
| InChI | InChI=1S/C19H31N5O2S/c1-2-10-26-16-9-8-14(11-15(16)22-19-24-23-18(20)27-19)17(25)21-12-13-6-4-3-5-7-13/h6,14-16H,2-5,7-12H2,1H3,(H2,20,23)(H,21,25)(H,22,24)/t14-,15+,16+/m0/s1 |
| InChIKey | GHPIMLGRGOPUDU-ARFHVFGLSA-N |
| XLogP | 3.11 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|