C20H25N3O2S2 — CID 162635032
N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-2-carboxamide (PubChem CID 162635032) has the molecular formula C20H25N3O2S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-2-carboxamide.
| Compound Name | N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-2-carboxamide |
|---|---|
| PubChem CID | 162635032 |
| Molecular Formula | C20H25N3O2S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-2-carboxamide |
| SMILES | Cc1nc2c(s1)CCCC2NC(=O)c1cc2c(s1)CCOC21CCNCC1 |
| InChI | InChI=1S/C20H25N3O2S2/c1-12-22-18-14(3-2-4-16(18)26-12)23-19(24)17-11-13-15(27-17)5-10-25-20(13)6-8-21-9-7-20/h11,14,21H,2-10H2,1H3,(H,23,24) |
| InChIKey | FIUKMRQYEWXBDF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |