C13H18N6O2 — CID 162635768
6-[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-7H-purin-2-amine (PubChem CID 162635768) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 6-[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-7H-purin-2-amine.
| Compound Name | 6-[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 162635768 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 6-[(3aR,6aS)-3a-(methoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-7H-purin-2-amine |
| SMILES | COC[C@@]12COC[C@@H]1CN(c1nc(N)nc3nc[nH]c13)C2 |
| InChI | InChI=1S/C13H18N6O2/c1-20-5-13-4-19(2-8(13)3-21-6-13)11-9-10(16-7-15-9)17-12(14)18-11/h7-8H,2-6H2,1H3,(H3,14,15,16,17,18)/t8-,13-/m0/s1 |
| InChIKey | OJDRUMOHPOIIGE-SDBXPKJASA-N |
| XLogP | 0.03 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |