C16H20N2O — CID 162636219
2-[4-(1-methoxyethyl)phenyl]-4,5,6-trimethylpyrimidine (PubChem CID 162636219) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[4-(1-methoxyethyl)phenyl]-4,5,6-trimethylpyrimidine.
| Compound Name | 2-[4-(1-methoxyethyl)phenyl]-4,5,6-trimethylpyrimidine |
|---|---|
| PubChem CID | 162636219 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-[4-(1-methoxyethyl)phenyl]-4,5,6-trimethylpyrimidine |
| SMILES | COC(C)c1ccc(-c2nc(C)c(C)c(C)n2)cc1 |
| InChI | InChI=1S/C16H20N2O/c1-10-11(2)17-16(18-12(10)3)15-8-6-14(7-9-15)13(4)19-5/h6-9,13H,1-5H3 |
| InChIKey | ZADIUQNOSDTRLM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |