C17H25F3N4O — CID 162636329
(3aS,4S,7aR)-4-ethyl-2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 162636329) has the molecular formula C17H25F3N4O and a molecular weight of 358.41 g/mol. Its IUPAC name is (3aS,4S,7aR)-4-ethyl-2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aS,4S,7aR)-4-ethyl-2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 162636329 |
| Molecular Formula | C17H25F3N4O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (3aS,4S,7aR)-4-ethyl-2-[2-(ethylamino)-6-(trifluoromethyl)pyrimidin-4-yl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | CCNc1nc(N2C[C@@H]3CCC[C@@](O)(CC)[C@@H]3C2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H25F3N4O/c1-3-16(25)7-5-6-11-9-24(10-12(11)16)14-8-13(17(18,19)20)22-15(23-14)21-4-2/h8,11-12,25H,3-7,9-10H2,1-2H3,(H,21,22,23)/t11-,12+,16-/m0/s1 |
| InChIKey | VDDKPDJXRZXIRW-OZVIIMIRSA-N |
| XLogP | 3.30 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |