C36H40ClN5O6 — CID 162637050
(5R)-5-[9-[5-(2-chlorophenyl)-2-methylfuran-3-carbonyl]-20-methoxy-18-oxa-3,6,9,14-tetrazatricyclo[17.3.1.02,6]tricosa-1(23),2,4,19,21-pentaene-14-carbonyl]pyrrolidin-2-one (PubChem CID 162637050) has the molecular formula C36H40ClN5O6 and a molecular weight of 674.20 g/mol. Its IUPAC name is (5R)-5-[9-[5-(2-chlorophenyl)-2-methylfuran-3-carbonyl]-20-methoxy-18-oxa-3,6,9,14-tetrazatricyclo[17.3.1.02,6]tricosa-1(23),2,4,19,21-pentaene-14-carbonyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[9-[5-(2-chlorophenyl)-2-methylfuran-3-carbonyl]-20-methoxy-18-oxa-3,6,9,14-tetrazatricyclo[17.3.1.02,6]tricosa-1(23),2,4,19,21-pentaene-14-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 162637050 |
| Molecular Formula | C36H40ClN5O6 |
| Molecular Weight | 674.20 g/mol |
| Exact Mass | 673.27 |
| IUPAC Name | (5R)-5-[9-[5-(2-chlorophenyl)-2-methylfuran-3-carbonyl]-20-methoxy-18-oxa-3,6,9,14-tetrazatricyclo[17.3.1.02,6]tricosa-1(23),2,4,19,21-pentaene-14-carbonyl]pyrrolidin-2-one |
| SMILES | COc1ccc2cc1OCCCN(C(=O)[C@H]1CCC(=O)N1)CCCCN(C(=O)c1cc(-c3ccccc3Cl)oc1C)CCn1ccnc1-2 |
| InChI | InChI=1S/C36H40ClN5O6/c1-24-27(23-31(48-24)26-8-3-4-9-28(26)37)35(44)42-16-6-5-15-41(36(45)29-11-13-33(43)39-29)17-7-21-47-32-22-25(10-12-30(32)46-2)34-38-14-18-40(34)19-20-42/h3-4,8-10,12,14,18,22-23,29H,5-7,11,13,15-17,19-21H2,1-2H3,(H,39,43)/t29-/m1/s1 |
| InChIKey | LVPWPUYNNBJYNB-GDLZYMKVSA-N |
| XLogP | 5.59 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.20 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |