C14H21N5O3 — CID 162638100
5-[[[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylamino]methyl]-N-methyl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 162638100) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-[[[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylamino]methyl]-N-methyl-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-[[[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylamino]methyl]-N-methyl-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 162638100 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 5-[[[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-methylamino]methyl]-N-methyl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CNC(=O)c1noc(CN(C)[C@H]2C[C@H]3CC(=O)NC[C@H]3C2)n1 |
| InChI | InChI=1S/C14H21N5O3/c1-15-14(21)13-17-12(22-18-13)7-19(2)10-3-8-5-11(20)16-6-9(8)4-10/h8-10H,3-7H2,1-2H3,(H,15,21)(H,16,20)/t8-,9+,10-/m0/s1 |
| InChIKey | CAULDNDPLBOGQP-AEJSXWLSSA-N |
| XLogP | -0.22 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |