C10H15NO — CID 162639395
(NE)-N-(4,7,7-trimethyl-2-bicyclo[4.1.0]hept-3-enylidene)hydroxylamine (PubChem CID 162639395) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (NE)-N-(4,7,7-trimethyl-2-bicyclo[4.1.0]hept-3-enylidene)hydroxylamine.
| Compound Name | (NE)-N-(4,7,7-trimethyl-2-bicyclo[4.1.0]hept-3-enylidene)hydroxylamine |
|---|---|
| PubChem CID | 162639395 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (NE)-N-(4,7,7-trimethyl-2-bicyclo[4.1.0]hept-3-enylidene)hydroxylamine |
| SMILES | CC1=C/C(=N\O)C2C(C1)C2(C)C |
| InChI | InChI=1S/C10H15NO/c1-6-4-7-9(10(7,2)3)8(5-6)11-12/h5,7,9,12H,4H2,1-3H3/b11-8+ |
| InChIKey | XXUMWJGLWLLRLD-DHZHZOJOSA-N |
| XLogP | 2.44 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|