About 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide
4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide (PubChem CID 162639526) has the molecular formula C20H22BrClF3NO
and a molecular weight of 464.75 g/mol. Its IUPAC name is 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide.
Molecular Properties
| Compound Name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide |
| PubChem CID | 162639526 |
| Molecular Formula | C20H22BrClF3NO |
| Molecular Weight | 464.75 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide |
| SMILES | Br.OC1(c2ccc(Cl)c(C(F)(F)F)c2)CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H21ClF3NO.BrH/c21-18-7-6-16(14-17(18)20(22,23)24)19(26)9-12-25(13-10-19)11-8-15-4-2-1-3-5-15;/h1-7,14,26H,8-13H2;1H |
| InChIKey | SEZYALOFQDWPFO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.75 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide?
The IUPAC name of 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide (CID 162639526) is 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide.
What is the SMILES notation for 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide?
The canonical SMILES for 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide is Br.OC1(c2ccc(Cl)c(C(F)(F)F)c2)CCN(CCc2ccccc2)CC1.
What is the InChIKey of 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide?
The InChIKey is SEZYALOFQDWPFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClF3NO.BrH/c21-18-7-6-16(14-17(18)20(22,23)24)19(26)9-12-25(13-10-19)11-8-15-4-2-1-3-5-15;/h1-7,14,26H,8-13H2;1H.
What are the key properties of 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide?
4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide has a molecular weight of 464.75 g/mol, XLogP of 5.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2-phenylethyl)piperidin-4-ol;hydrobromide is sourced from PubChem (CID 162639526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).