C32H43O3- — CID 162639685
10-[(1R,2R,3aR,4R,6aR)-4-hydroxy-1-phenyl-6a-[(1S)-1-phenylethyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]decanoic acid (PubChem CID 162639685) has the molecular formula C32H43O3- and a molecular weight of 475.69 g/mol. Its IUPAC name is 10-[(1R,2R,3aR,4R,6aR)-4-hydroxy-1-phenyl-6a-[(1S)-1-phenylethyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]decanoic acid.
| Compound Name | 10-[(1R,2R,3aR,4R,6aR)-4-hydroxy-1-phenyl-6a-[(1S)-1-phenylethyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]decanoic acid |
|---|---|
| PubChem CID | 162639685 |
| Molecular Formula | C32H43O3- |
| Molecular Weight | 475.69 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | 10-[(1R,2R,3aR,4R,6aR)-4-hydroxy-1-phenyl-6a-[(1S)-1-phenylethyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]decanoic acid |
| SMILES | [CH2-][C@@H](c1ccccc1)[C@@]12CC[C@@H](O)[C@@H]1C[C@@H](CCCCCCCCCC(=O)O)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C32H43O3/c1-24(25-15-10-7-11-16-25)32-22-21-29(33)28(32)23-27(31(32)26-17-12-8-13-18-26)19-9-5-3-2-4-6-14-20-30(34)35/h7-8,10-13,15-18,24,27-29,31,33H,1-6,9,14,19-23H2,(H,34,35)/q-1/t24-,27+,28-,29+,31-,32-/m0/s1 |
| InChIKey | KVUODSJAIVENPY-TZVBMTEUSA-N |
| XLogP | 7.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.69 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|