C20H42NO2+ — CID 162639991
[(E,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]-dimethylazanium (PubChem CID 162639991) has the molecular formula C20H42NO2+ and a molecular weight of 328.56 g/mol. Its IUPAC name is [(E,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]-dimethylazanium.
| Compound Name | [(E,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 162639991 |
| Molecular Formula | C20H42NO2+ |
| Molecular Weight | 328.56 g/mol |
| Exact Mass | 328.32 |
| IUPAC Name | [(E,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]-dimethylazanium |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@H](CO)[NH+](C)C |
| InChI | InChI=1S/C20H41NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(18-22)21(2)3/h16-17,19-20,22-23H,4-15,18H2,1-3H3/p+1/b17-16+/t19-,20+/m0/s1 |
| InChIKey | YRXOQXUDKDCXME-YIVRLKKSSA-O |
| XLogP | 3.11 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|