About methanesulfonate;triethyl(sulfo)azanium
methanesulfonate;triethyl(sulfo)azanium (PubChem CID 162640057) has the molecular formula C7H19NO6S2
and a molecular weight of 277.36 g/mol. Its IUPAC name is methanesulfonate;triethyl(sulfo)azanium.
Molecular Properties
| Compound Name | methanesulfonate;triethyl(sulfo)azanium |
| PubChem CID | 162640057 |
| Molecular Formula | C7H19NO6S2 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | methanesulfonate;triethyl(sulfo)azanium |
| SMILES | CC[N+](CC)(CC)S(=O)(=O)O.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H15NO3S.CH4O3S/c1-4-7(5-2,6-3)11(8,9)10;1-5(2,3)4/h4-6H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | DKWFESBZMYSSED-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;triethyl(sulfo)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;triethyl(sulfo)azanium?
The IUPAC name of methanesulfonate;triethyl(sulfo)azanium (CID 162640057) is methanesulfonate;triethyl(sulfo)azanium.
What is the SMILES notation for methanesulfonate;triethyl(sulfo)azanium?
The canonical SMILES for methanesulfonate;triethyl(sulfo)azanium is CC[N+](CC)(CC)S(=O)(=O)O.CS(=O)(=O)[O-].
What is the InChIKey of methanesulfonate;triethyl(sulfo)azanium?
The InChIKey is DKWFESBZMYSSED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3S.CH4O3S/c1-4-7(5-2,6-3)11(8,9)10;1-5(2,3)4/h4-6H2,1-3H3;1H3,(H,2,3,4).
What are the key properties of methanesulfonate;triethyl(sulfo)azanium?
methanesulfonate;triethyl(sulfo)azanium has a molecular weight of 277.36 g/mol, XLogP of -0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;triethyl(sulfo)azanium is sourced from PubChem (CID 162640057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).