C20H14N6O3 — CID 162640280
14-amino-15-[(4-methoxyphenyl)diazenyl]-2-oxa-12,13,17-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3,5,7,9,13,15-heptaen-11-one (PubChem CID 162640280) has the molecular formula C20H14N6O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is 14-amino-15-[(4-methoxyphenyl)diazenyl]-2-oxa-12,13,17-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3,5,7,9,13,15-heptaen-11-one.
| Compound Name | 14-amino-15-[(4-methoxyphenyl)diazenyl]-2-oxa-12,13,17-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3,5,7,9,13,15-heptaen-11-one |
|---|---|
| PubChem CID | 162640280 |
| Molecular Formula | C20H14N6O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 14-amino-15-[(4-methoxyphenyl)diazenyl]-2-oxa-12,13,17-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),3,5,7,9,13,15-heptaen-11-one |
| SMILES | COc1ccc(/N=N/c2c(N)nn3c(=O)c4cc5ccccc5oc4nc23)cc1 |
| InChI | InChI=1S/C20H14N6O3/c1-28-13-8-6-12(7-9-13)23-24-16-17(21)25-26-18(16)22-19-14(20(26)27)10-11-4-2-3-5-15(11)29-19/h2-10H,1H3,(H2,21,25)/b24-23+ |
| InChIKey | BPLHFGRFMLRFSQ-WCWDXBQESA-N |
| XLogP | 4.00 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|