C13H14N2 — CID 162640474
(1S)-1-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridin-2-ylethanamine (PubChem CID 162640474) has the molecular formula C13H14N2 and a molecular weight of 203.30 g/mol. Its IUPAC name is (1S)-1-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridin-2-ylethanamine.
| Compound Name | (1S)-1-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 162640474 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 203.30 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (1S)-1-(2,3,4,5,6-pentadeuteriophenyl)-2-pyridin-2-ylethanamine |
| SMILES | [2H]c1c([2H])c([2H])c([C@@H](N)Cc2ccccn2)c([2H])c1[2H] |
| InChI | InChI=1S/C13H14N2/c14-13(11-6-2-1-3-7-11)10-12-8-4-5-9-15-12/h1-9,13H,10,14H2/t13-/m0/s1/i1D,2D,3D,6D,7D |
| InChIKey | FWUQWDCOOWEXRY-LSFNQILDSA-N |
| XLogP | 2.32 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |