C10H15N5O2 — CID 162641502
2-[2-(2-aminopurin-9-yl)-1,1,2,2-tetradeuterioethyl]propane-1,3-diol (PubChem CID 162641502) has the molecular formula C10H15N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[2-(2-aminopurin-9-yl)-1,1,2,2-tetradeuterioethyl]propane-1,3-diol.
| Compound Name | 2-[2-(2-aminopurin-9-yl)-1,1,2,2-tetradeuterioethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 162641502 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-[2-(2-aminopurin-9-yl)-1,1,2,2-tetradeuterioethyl]propane-1,3-diol |
| SMILES | [2H]C([2H])(C(CO)CO)C([2H])([2H])n1cnc2cnc(N)nc21 |
| InChI | InChI=1S/C10H15N5O2/c11-10-12-3-8-9(14-10)15(6-13-8)2-1-7(4-16)5-17/h3,6-7,16-17H,1-2,4-5H2,(H2,11,12,14)/i1D2,2D2 |
| InChIKey | WJOWACPJSFGNRM-LNLMKGTHSA-N |
| XLogP | -0.60 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |