C14H10F3N7 — CID 162642859
3-[[6-(2,2,2-trifluoroethylamino)-7H-purin-2-yl]amino]benzonitrile (PubChem CID 162642859) has the molecular formula C14H10F3N7 and a molecular weight of 333.28 g/mol. Its IUPAC name is 3-[[6-(2,2,2-trifluoroethylamino)-7H-purin-2-yl]amino]benzonitrile.
| Compound Name | 3-[[6-(2,2,2-trifluoroethylamino)-7H-purin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 162642859 |
| Molecular Formula | C14H10F3N7 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-[[6-(2,2,2-trifluoroethylamino)-7H-purin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1cccc(Nc2nc(NCC(F)(F)F)c3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C14H10F3N7/c15-14(16,17)6-19-11-10-12(21-7-20-10)24-13(23-11)22-9-3-1-2-8(4-9)5-18/h1-4,7H,6H2,(H3,19,20,21,22,23,24) |
| InChIKey | OKYHZXVFZIERIY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |