C25H24ClN5O3 — CID 162642945
(3Z)-3-[[4-[(2-chloroacetyl)amino]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-N-[(1R)-1-pyridin-4-ylethyl]-1H-indole-5-carboxamide (PubChem CID 162642945) has the molecular formula C25H24ClN5O3 and a molecular weight of 477.95 g/mol. Its IUPAC name is (3Z)-3-[[4-[(2-chloroacetyl)amino]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-N-[(1R)-1-pyridin-4-ylethyl]-1H-indole-5-carboxamide.
| Compound Name | (3Z)-3-[[4-[(2-chloroacetyl)amino]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-N-[(1R)-1-pyridin-4-ylethyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 162642945 |
| Molecular Formula | C25H24ClN5O3 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (3Z)-3-[[4-[(2-chloroacetyl)amino]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-N-[(1R)-1-pyridin-4-ylethyl]-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(C(=O)N[C@H](C)c4ccncc4)cc32)c(C)c1NC(=O)CCl |
| InChI | InChI=1S/C25H24ClN5O3/c1-13-21(28-15(3)23(13)31-22(32)12-26)11-19-18-10-17(4-5-20(18)30-25(19)34)24(33)29-14(2)16-6-8-27-9-7-16/h4-11,14,28H,12H2,1-3H3,(H,29,33)(H,30,34)(H,31,32)/b19-11-/t14-/m1/s1 |
| InChIKey | JQZODHCAKPDDOC-AXLWCPOOSA-N |
| XLogP | 4.19 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|