About N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide
N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide (PubChem CID 162642965) has the molecular formula C16H17N5O2
and a molecular weight of 311.35 g/mol. Its IUPAC name is N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide |
| PubChem CID | 162642965 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide |
| SMILES | CCc1nc(-c2ccc(CNC(=O)c3ccnn3C)cc2)no1 |
| InChI | InChI=1S/C16H17N5O2/c1-3-14-19-15(20-23-14)12-6-4-11(5-7-12)10-17-16(22)13-8-9-18-21(13)2/h4-9H,3,10H2,1-2H3,(H,17,22) |
| InChIKey | OSPLFORFKNOFOR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide?
The IUPAC name of N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide (CID 162642965) is N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide.
What is the SMILES notation for N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide?
The canonical SMILES for N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide is CCc1nc(-c2ccc(CNC(=O)c3ccnn3C)cc2)no1.
What is the InChIKey of N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide?
The InChIKey is OSPLFORFKNOFOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O2/c1-3-14-19-15(20-23-14)12-6-4-11(5-7-12)10-17-16(22)13-8-9-18-21(13)2/h4-9H,3,10H2,1-2H3,(H,17,22).
What are the key properties of N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide?
N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide has a molecular weight of 311.35 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-2-methylpyrazole-3-carboxamide is sourced from PubChem (CID 162642965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).