C18H22N4O — CID 162643000
3,3-dimethyl-16-[2-(methylamino)ethyl]-6,7,16-triazatetracyclo[11.2.1.05,15.09,14]hexadeca-1(15),5,9(14),10,12-pentaen-8-one (PubChem CID 162643000) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 3,3-dimethyl-16-[2-(methylamino)ethyl]-6,7,16-triazatetracyclo[11.2.1.05,15.09,14]hexadeca-1(15),5,9(14),10,12-pentaen-8-one.
| Compound Name | 3,3-dimethyl-16-[2-(methylamino)ethyl]-6,7,16-triazatetracyclo[11.2.1.05,15.09,14]hexadeca-1(15),5,9(14),10,12-pentaen-8-one |
|---|---|
| PubChem CID | 162643000 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3,3-dimethyl-16-[2-(methylamino)ethyl]-6,7,16-triazatetracyclo[11.2.1.05,15.09,14]hexadeca-1(15),5,9(14),10,12-pentaen-8-one |
| SMILES | CNCCn1c2c3c4c(cccc41)C(=O)NN=C3CC(C)(C)C2 |
| InChI | InChI=1S/C18H22N4O/c1-18(2)9-12-16-14(10-18)22(8-7-19-3)13-6-4-5-11(15(13)16)17(23)21-20-12/h4-6,19H,7-10H2,1-3H3,(H,21,23) |
| InChIKey | GQUWQXVESJLVLB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |