C30H43N11O5 — CID 162643152
N-[2-[[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]amino]-2-oxoethyl]-N-benzyl-1-(triazole-1-carbonyl)piperidine-4-carboxamide (PubChem CID 162643152) has the molecular formula C30H43N11O5 and a molecular weight of 637.75 g/mol. Its IUPAC name is N-[2-[[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]amino]-2-oxoethyl]-N-benzyl-1-(triazole-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-[[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]amino]-2-oxoethyl]-N-benzyl-1-(triazole-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 162643152 |
| Molecular Formula | C30H43N11O5 |
| Molecular Weight | 637.75 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | N-[2-[[6-[[(2S)-1-amino-6-azido-1-oxohexan-2-yl]amino]-6-oxohexyl]amino]-2-oxoethyl]-N-benzyl-1-(triazole-1-carbonyl)piperidine-4-carboxamide |
| SMILES | [N-]=[N+]=NCCCC[C@H](NC(=O)CCCCCNC(=O)CN(Cc1ccccc1)C(=O)C1CCN(C(=O)n2ccnn2)CC1)C(N)=O |
| InChI | InChI=1S/C30H43N11O5/c31-28(44)25(11-6-8-16-34-37-32)36-26(42)12-5-2-7-15-33-27(43)22-40(21-23-9-3-1-4-10-23)29(45)24-13-18-39(19-14-24)30(46)41-20-17-35-38-41/h1,3-4,9-10,17,20,24-25H,2,5-8,11-16,18-19,21-22H2,(H2,31,44)(H,33,43)(H,36,42)/t25-/m0/s1 |
| InChIKey | RFGHNUDEJGROLQ-VWLOTQADSA-N |
| XLogP | 2.11 |
| TPSA | 221.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.75 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|