C28H28N6OS — CID 162643158
(E)-3-[3,5-dimethyl-4-[2-[4-(piperazin-1-ylmethyl)anilino]thieno[2,3-d]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile (PubChem CID 162643158) has the molecular formula C28H28N6OS and a molecular weight of 496.64 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-4-[2-[4-(piperazin-1-ylmethyl)anilino]thieno[2,3-d]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[3,5-dimethyl-4-[2-[4-(piperazin-1-ylmethyl)anilino]thieno[2,3-d]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 162643158 |
| Molecular Formula | C28H28N6OS |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (E)-3-[3,5-dimethyl-4-[2-[4-(piperazin-1-ylmethyl)anilino]thieno[2,3-d]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1nc(Nc2ccc(CN3CCNCC3)cc2)nc2sccc12 |
| InChI | InChI=1S/C28H28N6OS/c1-19-16-22(4-3-10-29)17-20(2)25(19)35-26-24-9-15-36-27(24)33-28(32-26)31-23-7-5-21(6-8-23)18-34-13-11-30-12-14-34/h3-9,15-17,30H,11-14,18H2,1-2H3,(H,31,32,33)/b4-3+ |
| InChIKey | ONCITCRSYFARFQ-ONEGZZNKSA-N |
| XLogP | 5.79 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|