C15H18O5 — CID 162643161
(3S,6S,7R,8E,10R,12R)-10-hydroxy-6,10-dimethyl-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),8-diene-5,14-dione (PubChem CID 162643161) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (3S,6S,7R,8E,10R,12R)-10-hydroxy-6,10-dimethyl-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),8-diene-5,14-dione.
| Compound Name | (3S,6S,7R,8E,10R,12R)-10-hydroxy-6,10-dimethyl-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),8-diene-5,14-dione |
|---|---|
| PubChem CID | 162643161 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (3S,6S,7R,8E,10R,12R)-10-hydroxy-6,10-dimethyl-4,13-dioxatricyclo[10.2.1.03,7]pentadeca-1(15),8-diene-5,14-dione |
| SMILES | C[C@@H]1C(=O)O[C@H]2CC3=C[C@@H](C[C@@](C)(O)/C=C/[C@@H]21)OC3=O |
| InChI | InChI=1S/C15H18O5/c1-8-11-3-4-15(2,18)7-10-5-9(14(17)19-10)6-12(11)20-13(8)16/h3-5,8,10-12,18H,6-7H2,1-2H3/b4-3+/t8-,10-,11+,12-,15-/m0/s1 |
| InChIKey | PFJAKPWQAPCECT-DJUSWWOQSA-N |
| XLogP | 1.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|